Bacillomycin: Difference between revisions
Content deleted Content added
Citation bot (talk | contribs) m [579]Add: doi, pages, issue, volume, journal, title, year, author pars. 1-6. You can use this bot yourself. Report bugs here. |
m Open access bot: doi updated in citation with #oabot. |
||
(14 intermediate revisions by 11 users not shown) | |||
Line 1: | Line 1: | ||
{{Orphan|date=December 2012}} |
|||
{{Chembox |
{{Chembox |
||
⚫ | |||
| Watchedfields = changed |
|||
| Name = Bacillomycin D |
| Name = Bacillomycin D |
||
⚫ | |||
| verifiedrevid = 459512784 |
| verifiedrevid = 459512784 |
||
| ImageFile = Bacillomycin.svg |
| ImageFile = Bacillomycin.svg |
||
| |
| ImageName = |
||
| |
| IUPACName= 3-[3,9-Bis(2-amino-2-oxo-ethyl)-16-(1-hydroxyethyl)-19-(hydroxymethyl)-6-[(4-hydroxyphenyl)methyl]-13-octyl-2,5,8,11,15,18,21,24-octaoxo-1,4,7,10,14,17,20,23-octazabicyclo[23.3.0]octacosan-22-yl]propanoic acid |
||
| SystematicName = 3-[16,22-Bis(carbamoylmethyl)-9-(1-hydroxyethyl)-6-(hydroxymethyl)-19-[(4-hydroxyphenyl)methyl]-12-octyl-1,4,7,10,14,17,20,23-octaoxo-hexacosahydro-1''H''-pyrrolo[1,2-j]1,4,7,10,13,16,19,22-octaazacyclopentacosan-3-yl]propanoic acid |
| SystematicName = 3-[16,22-Bis(carbamoylmethyl)-9-(1-hydroxyethyl)-6-(hydroxymethyl)-19-[(4-hydroxyphenyl)methyl]-12-octyl-1,4,7,10,14,17,20,23-octaoxo-hexacosahydro-1''H''-pyrrolo[1,2-j]1,4,7,10,13,16,19,22-octaazacyclopentacosan-3-yl]propanoic acid |
||
| OtherNames = 3-[16,22-bis(carbamoylmethyl)-9-(1-hydroxyethyl)-6-(hydroxymethyl)-19-[(4-hydroxyphenyl)methyl]-12-octyl-1,4,7,10,14,17,20,23-octaoxo-octadecahydro-2''H''-pyrrolo[1,2-j]1,4,7,10,13,16,19,22-octaazacyclopentacosan-3-yl]propanoic acid |
| OtherNames = 3-[16,22-bis(carbamoylmethyl)-9-(1-hydroxyethyl)-6-(hydroxymethyl)-19-[(4-hydroxyphenyl)methyl]-12-octyl-1,4,7,10,14,17,20,23-octaoxo-octadecahydro-2''H''-pyrrolo[1,2-j]1,4,7,10,13,16,19,22-octaazacyclopentacosan-3-yl]propanoic acid |
||
| |
|Section1={{Chembox Identifiers |
||
| |
| CASNo = 1395-21-7 |
||
| |
| CASNo_Ref = {{Cascite|changed|EPA}} |
||
| PubChem = 3086051 |
|||
| |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 2342763 |
| ChemSpiderID = 2342763 |
||
| |
| SMILES = CCCCCCCCC1CC(=O)NC(CC(N)=O)C(=O)NC(CC2=CC=C(O)C=C2)C(=O)NC(CC(N)=O)C(=O)N2CCCC2C(=O)NC(CCC(O)=O)C(=O)NC(CO)C(=O)NC(C(C)O)C(=O)N1 |
||
| |
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
||
| StdInChI = 1S/C45H68N10O15/c1-3-4-5-6-7-8-10-26-20-36(61)49-30(21-34(46)59)41(66)51-29(19-25-12-14-27(58)15-13-25)40(65)52-31(22-35(47)60)45(70)55-18-9-11-33(55)43(68)50-28(16-17-37(62)63)39(64)53-32(23-56)42(67)54-38(24(2)57)44(69)48-26/h12-15,24,26,28-33,38,56-58H,3-11,16-23H2,1-2H3,(H2,46,59)(H2,47,60)(H,48,69)(H,49,61)(H,50,68)(H,51,66)(H,52,65)(H,53,64)(H,54,67)(H,62,63) |
| StdInChI = 1S/C45H68N10O15/c1-3-4-5-6-7-8-10-26-20-36(61)49-30(21-34(46)59)41(66)51-29(19-25-12-14-27(58)15-13-25)40(65)52-31(22-35(47)60)45(70)55-18-9-11-33(55)43(68)50-28(16-17-37(62)63)39(64)53-32(23-56)42(67)54-38(24(2)57)44(69)48-26/h12-15,24,26,28-33,38,56-58H,3-11,16-23H2,1-2H3,(H2,46,59)(H2,47,60)(H,48,69)(H,49,61)(H,50,68)(H,51,66)(H,52,65)(H,53,64)(H,54,67)(H,62,63) |
||
| |
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
||
| StdInChIKey = VLKSXJAPRDAENT-UHFFFAOYSA-N |
| StdInChIKey = VLKSXJAPRDAENT-UHFFFAOYSA-N |
||
| |
| MeSHName=}} |
||
|Section2= |
|Section2={{Chembox Properties |
||
| |
| C=45 | H=68 | N=10 | O=15 |
||
| |
| Appearance= |
||
| |
| Density= |
||
| |
| Solubility= |
||
}} |
}} |
||
|Section3= |
|Section3={{Chembox Hazards |
||
| |
| FlashPtC = |
||
}} |
}} |
||
}} |
}} |
||
'''Bacillomycins''' are a group of [[antifungal]] [[polypeptide antibiotic]]s isolated from ''[[Bacillus subtilis]]''. |
'''Bacillomycins''' are a group of [[fungicide|antifungal]] [[polypeptide antibiotic]]s isolated from ''[[Bacillus subtilis]]''. |
||
Examples include: |
Examples include: |
||
⚫ | |||
⚫ | |||
* Bacillomycin C (structure unknown)<ref name=Buckingham/> |
* Bacillomycin C (structure unknown)<ref name=Buckingham/> |
||
* Bacillomycin D (C<sub>45</sub>H<sub>68</sub>N<sub>10</sub>O<sub>15</sub>)<ref>{{cite journal | pmid = 7285926| year = 1981| |
* Bacillomycin D (C<sub>45</sub>H<sub>68</sub>N<sub>10</sub>O<sub>15</sub>)<ref>{{cite journal | pmid = 7285926| year = 1981| last1 = Peypoux| first1 = F| title = Structure of bacillomycin D, a new antibiotic of the iturin group| journal = European Journal of Biochemistry| volume = 118| issue = 2| pages = 323–7| last2 = Besson| first2 = F| last3 = Michel| first3 = G| last4 = Delcambe| first4 = L| doi=10.1111/j.1432-1033.1981.tb06405.x| doi-access = }}</ref> |
||
* Bacillomycin F (C<sub>52</sub>H<sub>84</sub>N<sub>12</sub>O<sub>14</sub>)<ref>{{PubChem|3086138}}</ref> |
* Bacillomycin F (C<sub>52</sub>H<sub>84</sub>N<sub>12</sub>O<sub>14</sub>)<ref>{{PubChem|3086138}}</ref> |
||
* Bacillomycin Fc (C<sub>52</sub>H<sub>84</sub>N<sub>12</sub>O<sub>14</sub>)<ref>{{PubChem|3086563}}</ref> |
* Bacillomycin Fc (C<sub>52</sub>H<sub>84</sub>N<sub>12</sub>O<sub>14</sub>)<ref>{{PubChem|3086563}}</ref> |
||
* Bacillomycin L (Landy substance)<ref name=Buckingham/><ref>{{cite journal | pmid = 24043450| year = 2013| |
* Bacillomycin L (Landy substance)<ref name=Buckingham/><ref>{{cite journal | pmid = 24043450| year = 2013| last1 = Zhang| first1 = B| title = Purification and partial characterization of bacillomycin L produced by Bacillus amyloliquefaciens K103 from lemon| journal = Applied Biochemistry and Biotechnology| volume = 171| issue = 8| pages = 2262–72| last2 = Dong| first2 = C| last3 = Shang| first3 = Q| last4 = Cong| first4 = Y| last5 = Kong| first5 = W| last6 = Li| first6 = P| doi = 10.1007/s12010-013-0424-7| s2cid = 9380325}}</ref> |
||
* Bacillomycin S (structure unknown)<ref name=Buckingham/> |
* Bacillomycin S (structure unknown)<ref name=Buckingham/> |
||
Line 48: | Line 47: | ||
[[Category:Polypeptide antibiotics]] |
[[Category:Polypeptide antibiotics]] |
||
[[Category:Antifungals]] |
|||
Latest revision as of 09:49, 18 August 2023
Names | |
---|---|
IUPAC name
3-[3,9-Bis(2-amino-2-oxo-ethyl)-16-(1-hydroxyethyl)-19-(hydroxymethyl)-6-[(4-hydroxyphenyl)methyl]-13-octyl-2,5,8,11,15,18,21,24-octaoxo-1,4,7,10,14,17,20,23-octazabicyclo[23.3.0]octacosan-22-yl]propanoic acid
| |
Systematic IUPAC name
3-[16,22-Bis(carbamoylmethyl)-9-(1-hydroxyethyl)-6-(hydroxymethyl)-19-[(4-hydroxyphenyl)methyl]-12-octyl-1,4,7,10,14,17,20,23-octaoxo-hexacosahydro-1H-pyrrolo[1,2-j]1,4,7,10,13,16,19,22-octaazacyclopentacosan-3-yl]propanoic acid | |
Other names
3-[16,22-bis(carbamoylmethyl)-9-(1-hydroxyethyl)-6-(hydroxymethyl)-19-[(4-hydroxyphenyl)methyl]-12-octyl-1,4,7,10,14,17,20,23-octaoxo-octadecahydro-2H-pyrrolo[1,2-j]1,4,7,10,13,16,19,22-octaazacyclopentacosan-3-yl]propanoic acid
| |
Identifiers | |
3D model (JSmol)
|
|
ChemSpider | |
PubChem CID
|
|
| |
| |
Properties | |
C45H68N10O15 | |
Molar mass | 989.094 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Bacillomycins are a group of antifungal polypeptide antibiotics isolated from Bacillus subtilis.
Examples include:
- Bacillomycin A (fungosin, structure unknown)[1][2]
- Bacillomycin C (structure unknown)[2]
- Bacillomycin D (C45H68N10O15)[3]
- Bacillomycin F (C52H84N12O14)[4]
- Bacillomycin Fc (C52H84N12O14)[5]
- Bacillomycin L (Landy substance)[2][6]
- Bacillomycin S (structure unknown)[2]
References[edit]
- ^ Bacillomycin A
- ^ a b c d John Buckingham (ed.). Dictionary of Natural Products. pp. 590–591.
- ^ Peypoux, F; Besson, F; Michel, G; Delcambe, L (1981). "Structure of bacillomycin D, a new antibiotic of the iturin group". European Journal of Biochemistry. 118 (2): 323–7. doi:10.1111/j.1432-1033.1981.tb06405.x. PMID 7285926.
- ^ CID 3086138 from PubChem
- ^ CID 3086563 from PubChem
- ^ Zhang, B; Dong, C; Shang, Q; Cong, Y; Kong, W; Li, P (2013). "Purification and partial characterization of bacillomycin L produced by Bacillus amyloliquefaciens K103 from lemon". Applied Biochemistry and Biotechnology. 171 (8): 2262–72. doi:10.1007/s12010-013-0424-7. PMID 24043450. S2CID 9380325.