Bacillomycin: Difference between revisions

From Wikipedia, the free encyclopedia
Content deleted Content added
KolbertBot (talk | contribs)
m Bot: HTTP→HTTPS (v485)
OAbot (talk | contribs)
m Open access bot: doi updated in citation with #oabot.
 
(6 intermediate revisions by 6 users not shown)
Line 1: Line 1:
{{Orphan|date=December 2012}}
{{Chembox
{{Chembox
| Verifiedfields = changed
| Verifiedfields = changed
Line 6: Line 5:
| verifiedrevid = 459512784
| verifiedrevid = 459512784
| ImageFile = Bacillomycin.svg
| ImageFile = Bacillomycin.svg
| ImageName =
| ImageName =
| IUPACName= 3-[3,9-Bis(2-amino-2-oxo-ethyl)-16-(1-hydroxyethyl)-19-(hydroxymethyl)-6-[(4-hydroxyphenyl)methyl]-13-octyl-2,5,8,11,15,18,21,24-octaoxo-1,4,7,10,14,17,20,23-octazabicyclo[23.3.0]octacosan-22-yl]propanoic acid
| IUPACName= 3-[3,9-Bis(2-amino-2-oxo-ethyl)-16-(1-hydroxyethyl)-19-(hydroxymethyl)-6-[(4-hydroxyphenyl)methyl]-13-octyl-2,5,8,11,15,18,21,24-octaoxo-1,4,7,10,14,17,20,23-octazabicyclo[23.3.0]octacosan-22-yl]propanoic acid
| SystematicName = 3-[16,22-Bis(carbamoylmethyl)-9-(1-hydroxyethyl)-6-(hydroxymethyl)-19-[(4-hydroxyphenyl)methyl]-12-octyl-1,4,7,10,14,17,20,23-octaoxo-hexacosahydro-1''H''-pyrrolo[1,2-j]1,4,7,10,13,16,19,22-octaazacyclopentacosan-3-yl]propanoic acid
| SystematicName = 3-[16,22-Bis(carbamoylmethyl)-9-(1-hydroxyethyl)-6-(hydroxymethyl)-19-[(4-hydroxyphenyl)methyl]-12-octyl-1,4,7,10,14,17,20,23-octaoxo-hexacosahydro-1''H''-pyrrolo[1,2-j]1,4,7,10,13,16,19,22-octaazacyclopentacosan-3-yl]propanoic acid
| OtherNames = 3-[16,22-bis(carbamoylmethyl)-9-(1-hydroxyethyl)-6-(hydroxymethyl)-19-[(4-hydroxyphenyl)methyl]-12-octyl-1,4,7,10,14,17,20,23-octaoxo-octadecahydro-2''H''-pyrrolo[1,2-j]1,4,7,10,13,16,19,22-octaazacyclopentacosan-3-yl]propanoic acid
| OtherNames = 3-[16,22-bis(carbamoylmethyl)-9-(1-hydroxyethyl)-6-(hydroxymethyl)-19-[(4-hydroxyphenyl)methyl]-12-octyl-1,4,7,10,14,17,20,23-octaoxo-octadecahydro-2''H''-pyrrolo[1,2-j]1,4,7,10,13,16,19,22-octaazacyclopentacosan-3-yl]propanoic acid
|Section1={{Chembox Identifiers
|Section1={{Chembox Identifiers
| CASNo = 1395-21-7
| CASNo_Ref = {{Cascite|changed|EPA}}
| PubChem = 3086051
| PubChem = 3086051
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2342763
| ChemSpiderID = 2342763
| SMILES = CCCCCCCCC1CC(=O)NC(CC(N)=O)C(=O)NC(CC2=CC=C(O)C=C2)C(=O)NC(CC(N)=O)C(=O)N2CCCC2C(=O)NC(CCC(O)=O)C(=O)NC(CO)C(=O)NC(C(C)O)C(=O)N1
| SMILES = CCCCCCCCC1CC(=O)NC(CC(N)=O)C(=O)NC(CC2=CC=C(O)C=C2)C(=O)NC(CC(N)=O)C(=O)N2CCCC2C(=O)NC(CCC(O)=O)C(=O)NC(CO)C(=O)NC(C(C)O)C(=O)N1
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C45H68N10O15/c1-3-4-5-6-7-8-10-26-20-36(61)49-30(21-34(46)59)41(66)51-29(19-25-12-14-27(58)15-13-25)40(65)52-31(22-35(47)60)45(70)55-18-9-11-33(55)43(68)50-28(16-17-37(62)63)39(64)53-32(23-56)42(67)54-38(24(2)57)44(69)48-26/h12-15,24,26,28-33,38,56-58H,3-11,16-23H2,1-2H3,(H2,46,59)(H2,47,60)(H,48,69)(H,49,61)(H,50,68)(H,51,66)(H,52,65)(H,53,64)(H,54,67)(H,62,63)
| StdInChI = 1S/C45H68N10O15/c1-3-4-5-6-7-8-10-26-20-36(61)49-30(21-34(46)59)41(66)51-29(19-25-12-14-27(58)15-13-25)40(65)52-31(22-35(47)60)45(70)55-18-9-11-33(55)43(68)50-28(16-17-37(62)63)39(64)53-32(23-56)42(67)54-38(24(2)57)44(69)48-26/h12-15,24,26,28-33,38,56-58H,3-11,16-23H2,1-2H3,(H2,46,59)(H2,47,60)(H,48,69)(H,49,61)(H,50,68)(H,51,66)(H,52,65)(H,53,64)(H,54,67)(H,62,63)
Line 21: Line 22:
| MeSHName=}}
| MeSHName=}}
|Section2={{Chembox Properties
|Section2={{Chembox Properties
| C=45 | H=68 | N=10 | O=15
| C=45 | H=68 | N=10 | O=15
| Appearance=
| Appearance=
| Density=
| Density=
| Solubility=
| Solubility=
}}
}}
|Section3={{Chembox Hazards
|Section3={{Chembox Hazards
| FlashPtC =
| FlashPtC =
}}
}}
}}
}}
Line 34: Line 35:


Examples include:
Examples include:

* Bacillomycin A (fungosin, structure unknown)<ref>[https://www.uniprot.org/uniprot/G1FUQ9 Bacillomycin A]</ref><ref name=Buckingham >{{cite book | title = Dictionary of Natural Products | editor = John Buckingham | pages = 590–591}}</ref>
* Bacillomycin A (fungosin, structure unknown)<ref>[https://www.uniprot.org/uniprot/G1FUQ9 Bacillomycin A]</ref><ref name=Buckingham >{{cite book | title = Dictionary of Natural Products | editor = John Buckingham | pages = 590–591}}</ref>
* Bacillomycin C (structure unknown)<ref name=Buckingham/>
* Bacillomycin C (structure unknown)<ref name=Buckingham/>
* Bacillomycin D (C<sub>45</sub>H<sub>68</sub>N<sub>10</sub>O<sub>15</sub>)<ref>{{cite journal | pmid = 7285926| year = 1981| author1 = Peypoux| first1 = F| title = Structure of bacillomycin D, a new antibiotic of the iturin group| journal = European Journal of Biochemistry / FEBS| volume = 118| issue = 2| pages = 323–7| last2 = Besson| first2 = F| last3 = Michel| first3 = G| last4 = Delcambe| first4 = L| doi=10.1111/j.1432-1033.1981.tb06405.x}}</ref>
* Bacillomycin D (C<sub>45</sub>H<sub>68</sub>N<sub>10</sub>O<sub>15</sub>)<ref>{{cite journal | pmid = 7285926| year = 1981| last1 = Peypoux| first1 = F| title = Structure of bacillomycin D, a new antibiotic of the iturin group| journal = European Journal of Biochemistry| volume = 118| issue = 2| pages = 323–7| last2 = Besson| first2 = F| last3 = Michel| first3 = G| last4 = Delcambe| first4 = L| doi=10.1111/j.1432-1033.1981.tb06405.x| doi-access = }}</ref>
* Bacillomycin F (C<sub>52</sub>H<sub>84</sub>N<sub>12</sub>O<sub>14</sub>)<ref>{{PubChem|3086138}}</ref>
* Bacillomycin F (C<sub>52</sub>H<sub>84</sub>N<sub>12</sub>O<sub>14</sub>)<ref>{{PubChem|3086138}}</ref>
* Bacillomycin Fc (C<sub>52</sub>H<sub>84</sub>N<sub>12</sub>O<sub>14</sub>)<ref>{{PubChem|3086563}}</ref>
* Bacillomycin Fc (C<sub>52</sub>H<sub>84</sub>N<sub>12</sub>O<sub>14</sub>)<ref>{{PubChem|3086563}}</ref>
* Bacillomycin L (Landy substance)<ref name=Buckingham/><ref>{{cite journal | pmid = 24043450| year = 2013| author1 = Zhang| first1 = B| title = Purification and partial characterization of bacillomycin L produced by Bacillus amyloliquefaciens K103 from lemon| journal = Applied Biochemistry and Biotechnology| volume = 171| issue = 8| pages = 2262–72| last2 = Dong| first2 = C| last3 = Shang| first3 = Q| last4 = Cong| first4 = Y| last5 = Kong| first5 = W| last6 = Li| first6 = P| doi = 10.1007/s12010-013-0424-7}}</ref>
* Bacillomycin L (Landy substance)<ref name=Buckingham/><ref>{{cite journal | pmid = 24043450| year = 2013| last1 = Zhang| first1 = B| title = Purification and partial characterization of bacillomycin L produced by Bacillus amyloliquefaciens K103 from lemon| journal = Applied Biochemistry and Biotechnology| volume = 171| issue = 8| pages = 2262–72| last2 = Dong| first2 = C| last3 = Shang| first3 = Q| last4 = Cong| first4 = Y| last5 = Kong| first5 = W| last6 = Li| first6 = P| doi = 10.1007/s12010-013-0424-7| s2cid = 9380325}}</ref>
* Bacillomycin S (structure unknown)<ref name=Buckingham/>
* Bacillomycin S (structure unknown)<ref name=Buckingham/>



Latest revision as of 09:49, 18 August 2023

Bacillomycin D
Names
IUPAC name
3-[3,9-Bis(2-amino-2-oxo-ethyl)-16-(1-hydroxyethyl)-19-(hydroxymethyl)-6-[(4-hydroxyphenyl)methyl]-13-octyl-2,5,8,11,15,18,21,24-octaoxo-1,4,7,10,14,17,20,23-octazabicyclo[23.3.0]octacosan-22-yl]propanoic acid
Systematic IUPAC name
3-[16,22-Bis(carbamoylmethyl)-9-(1-hydroxyethyl)-6-(hydroxymethyl)-19-[(4-hydroxyphenyl)methyl]-12-octyl-1,4,7,10,14,17,20,23-octaoxo-hexacosahydro-1H-pyrrolo[1,2-j]1,4,7,10,13,16,19,22-octaazacyclopentacosan-3-yl]propanoic acid
Other names
3-[16,22-bis(carbamoylmethyl)-9-(1-hydroxyethyl)-6-(hydroxymethyl)-19-[(4-hydroxyphenyl)methyl]-12-octyl-1,4,7,10,14,17,20,23-octaoxo-octadecahydro-2H-pyrrolo[1,2-j]1,4,7,10,13,16,19,22-octaazacyclopentacosan-3-yl]propanoic acid
Identifiers
3D model (JSmol)
ChemSpider
  • InChI=1S/C45H68N10O15/c1-3-4-5-6-7-8-10-26-20-36(61)49-30(21-34(46)59)41(66)51-29(19-25-12-14-27(58)15-13-25)40(65)52-31(22-35(47)60)45(70)55-18-9-11-33(55)43(68)50-28(16-17-37(62)63)39(64)53-32(23-56)42(67)54-38(24(2)57)44(69)48-26/h12-15,24,26,28-33,38,56-58H,3-11,16-23H2,1-2H3,(H2,46,59)(H2,47,60)(H,48,69)(H,49,61)(H,50,68)(H,51,66)(H,52,65)(H,53,64)(H,54,67)(H,62,63) ☒N
    Key: VLKSXJAPRDAENT-UHFFFAOYSA-N ☒N
  • CCCCCCCCC1CC(=O)NC(CC(N)=O)C(=O)NC(CC2=CC=C(O)C=C2)C(=O)NC(CC(N)=O)C(=O)N2CCCC2C(=O)NC(CCC(O)=O)C(=O)NC(CO)C(=O)NC(C(C)O)C(=O)N1
Properties
C45H68N10O15
Molar mass 989.094 g·mol−1
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
☒N verify (what is checkY☒N ?)

Bacillomycins are a group of antifungal polypeptide antibiotics isolated from Bacillus subtilis.

Examples include:

  • Bacillomycin A (fungosin, structure unknown)[1][2]
  • Bacillomycin C (structure unknown)[2]
  • Bacillomycin D (C45H68N10O15)[3]
  • Bacillomycin F (C52H84N12O14)[4]
  • Bacillomycin Fc (C52H84N12O14)[5]
  • Bacillomycin L (Landy substance)[2][6]
  • Bacillomycin S (structure unknown)[2]

References[edit]

  1. ^ Bacillomycin A
  2. ^ a b c d John Buckingham (ed.). Dictionary of Natural Products. pp. 590–591.
  3. ^ Peypoux, F; Besson, F; Michel, G; Delcambe, L (1981). "Structure of bacillomycin D, a new antibiotic of the iturin group". European Journal of Biochemistry. 118 (2): 323–7. doi:10.1111/j.1432-1033.1981.tb06405.x. PMID 7285926.
  4. ^ CID 3086138 from PubChem
  5. ^ CID 3086563 from PubChem
  6. ^ Zhang, B; Dong, C; Shang, Q; Cong, Y; Kong, W; Li, P (2013). "Purification and partial characterization of bacillomycin L produced by Bacillus amyloliquefaciens K103 from lemon". Applied Biochemistry and Biotechnology. 171 (8): 2262–72. doi:10.1007/s12010-013-0424-7. PMID 24043450. S2CID 9380325.