Dienestrol: Difference between revisions
Content deleted Content added
Script assisted update of chemical identifiers from ChemSpider for the Chem/Drugbox validation project. |
Updating {{drugbox}} (no changed fields - added verified revid - updated 'CASNo_Ref') per Chem/Drugbox validation (report errors or [[user talk:CheMoBo |
||
| Line 1: | Line 1: | ||
{{drugbox |
{{drugbox |
||
| verifiedrevid = 322166428 |
|||
| IUPAC_name = 4-[4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol |
| IUPAC_name = 4-[4-(4-hydroxyphenyl)hexa-2,4-dien-3-yl]phenol |
||
| image = Dienestrol.svg |
| image = Dienestrol.svg |
||
| Line 6: | Line 7: | ||
| smiles = Oc2ccc(C(/C(c1ccc(O)cc1)=C/C)=C\C)cc2 |
| smiles = Oc2ccc(C(/C(c1ccc(O)cc1)=C/C)=C\C)cc2 |
||
| InChIKey = NFDFQCUYFHCNBW-SCGPFSFSBL |
| InChIKey = NFDFQCUYFHCNBW-SCGPFSFSBL |
||
| CASNo_Ref = {{cascite}} |
|||
| CAS_number = 84-17-3 |
| CAS_number = 84-17-3 |
||
| ATC_prefix = G03 |
| ATC_prefix = G03 |
||
Revision as of 17:18, 26 October 2009
 | |
| Clinical data | |
|---|---|
| ATC code | |
| Pharmacokinetic data | |
| Protein binding | 50 to 80% |
| Identifiers | |
| |
| CAS Number | |
| PubChem CID | |
| DrugBank | |
| ChemSpider | |
| CompTox Dashboard (EPA) | |
| ECHA InfoCard | 100.001.381 |
| Chemical and physical data | |
| Formula | C18H18O2 |
| Molar mass | 266.334 g/mol g·mol−1 |
| 3D model (JSmol) | |
| |
| (verify) | |
Dienestrol is a synthetic estrogen.
 | This pharmacology-related article is a stub. You can help Wikipedia by expanding it. |