Amyrin: Difference between revisions
Content deleted Content added
ArmbrustBot (talk | contribs) m →References: removing category per Wikipedia:Categories for discussion/Log/2013 September 21, removed: Category:Chemical compounds found in dandelion coffee using AWB |
m Chembox: rm/replace deprecated params. Fix unknown parameters (via AWB script) |
||
Line 9: | Line 9: | ||
| IUPACName = α: (3β)-Urs-12-en-3-ol<br>β: (3β)-Olean-12-en-3-ol |
| IUPACName = α: (3β)-Urs-12-en-3-ol<br>β: (3β)-Olean-12-en-3-ol |
||
| OtherNames = α: α-Amyrenol; α-Amirin; α-Amyrine; Urs-12-en-3β-ol; Viminalol<br>β: β-Amyrenol; β-Amirin; β-Amyrine; Olean-12-en-3β-ol; 3β-Hydroxyolean-12-ene |
| OtherNames = α: α-Amyrenol; α-Amirin; α-Amyrine; Urs-12-en-3β-ol; Viminalol<br>β: β-Amyrenol; β-Amirin; β-Amyrine; Olean-12-en-3β-ol; 3β-Hydroxyolean-12-ene |
||
| |
|Section1={{Chembox Identifiers |
||
| |
| CASNo = 638-95-9 |
||
| |
| CASNo_Ref = {{cascite|correct|CAS}} |
||
| |
| CASNo_Comment = (α) |
||
| |
| CASNo1 = 559-70-6 |
||
| |
| CASNo1_Ref = {{cascite|correct|CAS}} |
||
| |
| CASNo1_Comment = (β) |
||
| |
| PubChem = 73170 |
||
| |
| PubChem_Comment = (α) |
||
| |
| PubChem1 = 73145 |
||
| |
| PubChem1_Comment = (β) |
||
| |
| ChemSpiderID = 65935 |
||
| |
| ChemSpiderID_Comment = (α) |
||
| |
| ChemSpiderID1 = 65921 |
||
| |
| ChemSpiderID1_Comment = (β) |
||
| |
| SMILES = O[C@H]2CC[C@@]1([C@@H]3[C@](CC[C@H]1C2(C)C)(C)[C@]5(C(=C/C3)\[C@@H]4[C@@H](C)[C@H](C)CC[C@]4(C)CC5)C)C |
||
| |
| SMILES_Comment = (α) |
||
| |
| InChI = 1/C30H50O/c1-19-11-14-27(5)17-18-29(7)21(25(27)20(19)2)9-10-23-28(6)15-13-24(31)26(3,4)22(28)12-16-30(23,29)8/h9,19-20,22-25,31H,10-18H2,1-8H3/t19-,20+,22+,23-,24+,25+,27-,28+,29-,30-/m1/s1 |
||
| |
| InChI_Comment = (α) |
||
| |
| InChIKey = FSLPMRQHCOLESF-SFMCKYFRBG |
||
| |
| InChIKey_Comment = (α) |
||
| |
| StdInChI = 1S/C30H50O/c1-19-11-14-27(5)17-18-29(7)21(25(27)20(19)2)9-10-23-28(6)15-13-24(31)26(3,4)22(28)12-16-30(23,29)8/h9,19-20,22-25,31H,10-18H2,1-8H3/t19-,20+,22+,23-,24+,25+,27-,28+,29-,30-/m1/s1 |
||
| |
| StdInChI_Comment = (α) |
||
| |
| StdInChIKey = FSLPMRQHCOLESF-SFMCKYFRSA-N |
||
| |
| StdInChIKey_Comment = (α) |
||
| |
| SMILES1 = C[C@@]12CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O)C)C)[C@@H]1CC(CC2)(C)C)C |
||
| |
| SMILES1_Comment = (β) |
||
| |
| InChI1 = 1/C30H50O/c1-25(2)15-16-27(5)17-18-29(7)20(21(27)19-25)9-10-23-28(6)13-12-24(31)26(3,4)22(28)11-14-30(23,29)8/h9,21-24,31H,10-19H2,1-8H3/t21-,22-,23+,24-,27+,28-,29+,30+/m0/s1 |
||
| |
| InChI1_Comment = (β) |
||
| |
| InChIKey1 = JFSHUTJDVKUMTJ-QHPUVITPBE |
||
| |
| InChIKey1_Comment = (β) |
||
| |
| StdInChI1 = 1S/C30H50O/c1-25(2)15-16-27(5)17-18-29(7)20(21(27)19-25)9-10-23-28(6)13-12-24(31)26(3,4)22(28)11-14-30(23,29)8/h9,21-24,31H,10-19H2,1-8H3/t21-,22-,23+,24-,27+,28-,29+,30+/m0/s1 |
||
| |
| StdInChI1_Comment = (β) |
||
| |
| StdInChIKey1 = JFSHUTJDVKUMTJ-QHPUVITPSA-N |
||
| |
| StdInChIKey1_Comment = (β) |
||
}} |
}} |
||
| |
|Section2={{Chembox Properties |
||
| |
| C=30 | H=50 | O=1 |
||
| |
| Appearance = |
||
| |
| Density = |
||
| |
| MeltingPt = α: 186 °C<ref>''[[Merck Index]], 11th Edition, '''653'''</ref><br>β: 197-187.5 °C<ref>''[[Merck Index]], 11th Edition, '''654'''</ref> |
||
| |
| BoilingPt = |
||
| |
| Solubility = |
||
}} |
}} |
||
| |
|Section3={{Chembox Hazards |
||
| |
| MainHazards = |
||
| |
| FlashPt = |
||
| |
| AutoignitionPt = |
||
}} |
}} |
||
}} |
}} |
Revision as of 19:32, 7 July 2015
α-Amyrin
| |
β-Amyrin
| |
Names | |
---|---|
IUPAC names
α: (3β)-Urs-12-en-3-ol
β: (3β)-Olean-12-en-3-ol | |
Other names
α: α-Amyrenol; α-Amirin; α-Amyrine; Urs-12-en-3β-ol; Viminalol
β: β-Amyrenol; β-Amirin; β-Amyrine; Olean-12-en-3β-ol; 3β-Hydroxyolean-12-ene | |
Identifiers | |
3D model (JSmol)
|
|
ChemSpider | |
PubChem CID
|
|
| |
| |
Properties | |
C30H50O | |
Molar mass | 426.729 g·mol−1 |
Melting point | α: 186 °C[1] β: 197-187.5 °C[2] |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
The amyrins are a pair of closely related natural chemical compounds of the triterpene class. They are designated α-amyrin and β-amyrin. Each has the chemical formula C30H50O. They are widely distributed in nature and have been isolated from a variety of plant sources. α-Amyrin is found in dandelion coffee.
References
- ^ Merck Index, 11th Edition, 653
- ^ Merck Index, 11th Edition, 654