Amyrin: Difference between revisions
Content deleted Content added
Plantsurfer (talk | contribs) →top: copy edit |
Plantsurfer (talk | contribs) copy edit Chembox |
||
Line 5: | Line 5: | ||
| ImageFile1 = beta-amyrin.svg |
| ImageFile1 = beta-amyrin.svg |
||
| ImageCaption1 = β-Amyrin |
| ImageCaption1 = β-Amyrin |
||
| IUPACName = α: (3β)-Urs-12-en-3-ol<br>β: (3β)-Olean-12-en-3-ol |
| IUPACName = α: (3β)-Urs-12-en-3-ol<br>β: (3β)-Olean-12-en-3-ol<br>δ: (3β)-Olean-13(18)-en-3-ol |
||
| OtherNames = α: α-Amyrenol; α-Amirin; α-Amyrine; Urs-12-en-3β-ol; Viminalol<br>β: β-Amyrenol; β-Amirin; β-Amyrine; Olean-12-en-3β-ol; 3β-Hydroxyolean-12-ene |
| OtherNames = α: α-Amyrenol; α-Amirin; α-Amyrine; Urs-12-en-3β-ol; Viminalol<br>β: β-Amyrenol; β-Amirin; β-Amyrine; Olean-12-en-3β-ol; 3β-Hydroxyolean-12-ene |
||
|Section1={{Chembox Identifiers |
|Section1={{Chembox Identifiers |
||
Line 14: | Line 14: | ||
| CASNo1_Ref = {{cascite|correct|CAS}} |
| CASNo1_Ref = {{cascite|correct|CAS}} |
||
| CASNo1_Comment = (β) |
| CASNo1_Comment = (β) |
||
| CASNo2 = 508-04-3 |
|||
| CASNo2_Ref = {{cascite|correct|CAS}} |
|||
| CASNo2_Comment = (δ) |
|||
| PubChem = 73170 |
| PubChem = 73170 |
||
| PubChem_Comment = (α) |
| PubChem_Comment = (α) |
||
| PubChem1 = 73145 |
| PubChem1 = 73145 |
||
| PubChem1_Comment = (β) |
| PubChem1_Comment = (β) |
||
| PubChem2 = 12358447 |
|||
| PubChem2_Comment = (δ) |
|||
| ChemSpiderID = 65935 |
| ChemSpiderID = 65935 |
||
| ChemSpiderID_Comment = (α) |
| ChemSpiderID_Comment = (α) |
||
| ChemSpiderID1 = 65921 |
| ChemSpiderID1 = 65921 |
||
| ChemSpiderID1_Comment = (β) |
| ChemSpiderID1_Comment = (β) |
||
| ChemSpiderID2 = 26333109 |
|||
| ChemSpiderID2_Comment = (δ) |
|||
| SMILES = O[C@H]2CC[C@@]1([C@@H]3[C@](CC[C@H]1C2(C)C)(C)[C@]5(C(=C/C3)\[C@@H]4[C@@H](C)[C@H](C)CC[C@]4(C)CC5)C)C |
| SMILES = O[C@H]2CC[C@@]1([C@@H]3[C@](CC[C@H]1C2(C)C)(C)[C@]5(C(=C/C3)\[C@@H]4[C@@H](C)[C@H](C)CC[C@]4(C)CC5)C)C |
||
| SMILES_Comment = (α) |
| SMILES_Comment = (α) |
Revision as of 15:56, 16 November 2016
α-Amyrin
| |
β-Amyrin
| |
Names | |
---|---|
IUPAC names
α: (3β)-Urs-12-en-3-ol
β: (3β)-Olean-12-en-3-ol δ: (3β)-Olean-13(18)-en-3-ol | |
Other names
α: α-Amyrenol; α-Amirin; α-Amyrine; Urs-12-en-3β-ol; Viminalol
β: β-Amyrenol; β-Amirin; β-Amyrine; Olean-12-en-3β-ol; 3β-Hydroxyolean-12-ene | |
Identifiers | |
3D model (JSmol)
|
|
ChemSpider | |
PubChem CID
|
|
| |
| |
Properties | |
C30H50O | |
Molar mass | 426.729 g·mol−1 |
Melting point | α: 186 °C[1] β: 197-187.5 °C[2] |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
The amyrins are three closely related natural chemical compounds of the triterpene class. They are designated α-amyrin, β-amyrin and δ-amyrin. Each is a pentacyclic triterpenol with the chemical formula C30H50O. They are widely distributed in nature and have been isolated from a variety of plant sources such as epicuticular wax. α-Amyrin is found in dandelion coffee.
References
- ^ Merck Index, 11th Edition, 653
- ^ Merck Index, 11th Edition, 654