Clobenpropit: Difference between revisions

Clobenpropit
Clinical data
ATC code	none;
Identifiers
	IUPAC name N'-[(4-chlorophenyl)methyl]-1-[3-(3H-imidazol-4-yl)propylsulfanyl]formamidine;
CAS Number	145231-45-4;
PubChem CID	2790;
IUPHAR/BPS	1223;
ChemSpider	2688;
ChEMBL	ChEMBL14690;
CompTox Dashboard (EPA)	DTXSID3043738 ;
Chemical and physical data
Formula	C14H17ClN4S
Molar mass	308.83 g/mol g·mol−1
3D model (JSmol)	Interactive image;
	SMILES C1=CC(=CC=C1CN=C(N)SCCCC2=CN=CN2)Cl;

Content deleted Content added

Inline

Revision as of 05:39, 2 September 2011

Clobenpropit is a histamine H₃ receptor antagonist.^[1] It has neuroprotective effects via stimulation of GABA release in the brain.^[2]

^ Sahlholm K, Nilsson J, Marcellino D, Fuxe K, Arhem P (2007). "The human histamine H3 receptor couples to GIRK channels in Xenopus oocytes". Eur. J. Pharmacol. 567 (3): 206–10. doi:10.1016/j.ejphar.2007.04.032. PMID 17537431.{{cite journal}}: CS1 maint: multiple names: authors list (link)
^ Dai H, Fu Q, Shen Y, Hu W, Zhang Z, Timmerman H, Leurs R, Chen Z. The histamine H3 receptor antagonist clobenpropit enhances GABA release to protect against NMDA-induced excitotoxicity through the cAMP/protein kinase A pathway in cultured cortical neurons. European Journal of Pharmacology. 2007 Jun 1;563(1-3):117-23. PMID 17350613

This pharmacology-related article is a stub. You can help Wikipedia by expanding it.

@@ Line 1: / Line 1: @@
 {{Drugbox
-| IUPAC_name               = ''N'''-[(4-chlorophenyl)methyl]-1-[3-(3''H''-imidazol-4-yl)propylsulfanyl]formamidine
+| IUPAC_name = ''N'''-[(4-chlorophenyl)methyl]-1-[3-(3''H''-imidazol-4-yl)propylsulfanyl]formamidine
-| image                    = Clobenpropit.svg
+| image = Clobenpropit.svg
-| CAS_number               = 145231-45-4
+<!--Clinical data-->
-| ATC_prefix               = none
+| tradename =
-| ATC_suffix               =
+| pregnancy_category =
-| PubChem                  = 2790
+| legal_status =
+| routes_of_administration =
+<!--Pharmacokinetic data-->
+| bioavailability =
+| metabolism =
+| elimination_half-life =
+| excretion =
+<!--Identifiers-->
+| CAS_number = 145231-45-4
+| ATC_prefix = none
+| ATC_suffix =
+| PubChem = 2790
 | IUPHAR_ligand = 1223
-| ChemSpiderID             = 2688
+| ChemSpiderID = 2688
 | ChEMBL = 14690
-| C = 14 | H = 17 | Cl = 1 | N = 4 | S = 1
+<!--Chemical data-->
-| molecular_weight         = 308.83 g/mol
+| C=14 | H=17 | Cl=1 | N=4 | S=1
-| smiles                   = C1=CC(=CC=C1CN=C(N)SCCCC2=CN=CN2)Cl
+| molecular_weight = 308.83 g/mol
-| bioavailability          =
+| smiles = C1=CC(=CC=C1CN=C(N)SCCCC2=CN=CN2)Cl
-| metabolism               =
-| elimination_half-life    =
-| excretion                =
-| pregnancy_category       =
-| legal_status             =
-| routes_of_administration =
 }}