Myrtenol: Difference between revisions

Myrtenol
Names
	IUPAC name (6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl)methanol
	Other names (±)-Myrtenol; 2-Pinen-10-ol; Pin-2-ene-10-ol; 10-Hydroxy-2-pinene;
Identifiers
CAS Number	515-00-4 ;
3D model (JSmol)	Interactive image;
ChEMBL	ChEMBL443408;
ChemSpider	10137;
ECHA InfoCard	100.007.449
EC Number	208-193-5;
KEGG	C11938;
PubChem CID	10582;
CompTox Dashboard (EPA)	DTXSID00862089 ;
	InChI InChI=1S/C10H16O/c1-10(2)8-4-3-7(6-11)9(10)5-8/h3,8-9,11H,4-6H2,1-2H3 Key: RXBQNMWIQKOSCS-UHFFFAOYSA-N;
	SMILES CC1(C2CC=C(C1C2)CO)C;
Properties
Chemical formula	C10H16O
Molar mass	152.237 g·mol−1
Boiling point	221.5 °C (430.7 °F; 494.6 K)
	Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). Infobox references

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

Inline

Latest revision as of 22:43, 30 July 2023

Myrtenol is a chemical compound isolated from plants in the genus Taxus.^[1]

References[edit]

^ Varlet, V.; Augsburger, M. (2013). "Monitoring of aglycons of yew glycosides (3,5-dimethoxyphenol, myrtenol and 1-octen-3-ol) as first indicator of yew presence". Drug Testing and Analysis. 5 (6): 474–479. doi:10.1002/dta.391. PMID 22371422.

This organic chemistry article is a stub. You can help Wikipedia by expanding it.

[1] Varlet, V.; Augsburger, M. (2013). "Monitoring of aglycons of yew glycosides (3,5-dimethoxyphenol, myrtenol and 1-octen-3-ol) as first indicator of yew presence". Drug Testing and Analysis. 5 (6): 474–479. doi:10.1002/dta.391. PMID 22371422.

[1]

@@ Line 1: / Line 1: @@
 {{Chembox
-| ImageFile = Myrtenol2.svg
+| ImageFile = Rac-myrtenol 1.svg
-|  ImageSize = 150px
+| ImageSize = 150px
-|  ImageAlt =
+| ImageAlt =
-| IUPACName =
+| IUPACName = (6,6-dimethylbicyclo[3.1.1]hept-2-en-2-yl)methanol
-| OtherNames =
+| OtherNames = {{Unbulleted list
+  | (±)-Myrtenol
-| Section1 = {{Chembox Identifiers
+  | 2-Pinen-10-ol
-|  CASNo =
+  | Pin-2-ene-10-ol
-|  PubChem = 10582
+  | 10-Hydroxy-2-pinene
-|  SMILES = }}
+  }}
-| Section2 = {{Chembox Properties
+|Section1={{Chembox Identifiers
-|  Formula =
-|  MolarMass =
+| CASNo = 515-00-4
+| CASNo_Ref = {{Cascite|correct|CAS}}
-|  Appearance =
-|  Density =
+| ChEMBL = 443408
-|  MeltingPt =
+| ChemSpiderID = 10137
-|  BoilingPt =
+| EC_number = 208-193-5
-|  Solubility = }}
+| KEGG = C11938
+| PubChem = 10582
-| Section3 = {{Chembox Hazards
+| StdInChI=1S/C10H16O/c1-10(2)8-4-3-7(6-11)9(10)5-8/h3,8-9,11H,4-6H2,1-2H3
-|  MainHazards =
+| StdInChIKey = RXBQNMWIQKOSCS-UHFFFAOYSA-N
-|  FlashPt =
+| SMILES = CC1(C2CC=C(C1C2)CO)C
-|  Autoignition = }}
+ }}
+|Section2={{Chembox Properties
+| C=10 | H=16 | O=1
+| Formula =
+| MolarMass =
+| Appearance =
+| Density =
+| MeltingPtC =
+| BoilingPtC = 221.5
+| Solubility = }}
+|Section3={{Chembox Hazards
+| MainHazards =
+| FlashPt =
+| AutoignitionPt = }}
 }}
+'''Myrtenol''' is a chemical compound isolated from plants in the genus ''[[Taxus]]''.<ref>{{cite journal | pmid = 22371422 | year = 2013 | last1 = Varlet | first1 = V. | last2 = Augsburger | first2 = M. | title = Monitoring of aglycons of yew glycosides (3,5-dimethoxyphenol, myrtenol and 1-octen-3-ol) as first indicator of yew presence | journal = Drug Testing and Analysis | volume = 5 | issue = 6 | pages = 474–479 | doi = 10.1002/dta.391 }}</ref>
-'''Myrtenol''' is a bio-active isolate of ''[[Taxus]]''.
-==External links==
+==See also==
+* [[Myrtenal]]
-* [http://www.ncbi.nlm.nih.gov/pubmed/22371422 Monitoring of aglycons of yew glycosides (3,5-dimethoxyphenol, myrtenol and 1-octen-3-ol) as first indicator of yew presence]
+==References==
-[[Category:Taxus]]
+{{reflist}}
+[[Category:Bicyclic compounds]]
+[[Category:Cycloalkenes]]
+[[Category:Primary alcohols]]
+[[Category:Monoterpenes]]
 {{organic-chem-stub}}

Latest revision as of 22:43, 30 July 2023

See also[edit]

References[edit]