Streptolydigin: Difference between revisions

From Wikipedia, the free encyclopedia
Content deleted Content added
OAbot (talk | contribs)
m Open access bot: doi added to citation with #oabot.
m Cleaned up using AutoEd
Line 6: Line 6:


<!--Clinical data-->
<!--Clinical data-->
| tradename =
| tradename =
| pregnancy_category =
| pregnancy_category =
| legal_status =
| legal_status =
| routes_of_administration =
| routes_of_administration =


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
| bioavailability =
| bioavailability =
| protein_bound =
| protein_bound =
| metabolism =
| metabolism =
| elimination_half-life =
| elimination_half-life =


Line 23: Line 23:
| UNII = 6MON4029Q8
| UNII = 6MON4029Q8
| ATC_prefix = none
| ATC_prefix = none
| ATC_suffix =
| ATC_suffix =
| ATC_supplemental =
| ATC_supplemental =
| PubChem = 220508
| PubChem = 220508
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
Line 32: Line 32:
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1236068
| ChEMBL = 1236068
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 45773
| ChEBI = 45773


<!--Chemical data-->
<!--Chemical data-->
| C=32 | H=44 | N=2 | O=9
| C=32 | H=44 | N=2 | O=9
| smiles = CNC(=O)C(C)C2C(=O)/C(C(=O)N2C1CCC(O)C(C)O1)=C(\O)/C=C/C(/C)=C/C(C)C5OC4(C)OC(\C=C/C34CO3)C5C
| smiles = CNC(=O)C(C)C2C(=O)/C(C(=O)N2C1CCC(O)C(C)O1)=C(\O)/C=C/C(/C)=C/C(C)C5OC4(C)OC(\C=C/C34CO3)C5C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

Revision as of 20:43, 8 January 2023

Streptolydigin
Clinical data
ATC code
  • none
Identifiers
  • 2-[4-[6-(1,6-dimethylspiro[8,9-dioxabicyclo[3.3.1]non-3-ene-2,2'-oxirane]-7
CAS Number
PubChem CID
DrugBank
ChemSpider
UNII
ChEBI
ChEMBL
CompTox Dashboard (EPA)
Chemical and physical data
FormulaC32H44N2O9
Molar mass600.709 g·mol−1
3D model (JSmol)
  • CNC(=O)C(C)C2C(=O)/C(C(=O)N2C1CCC(O)C(C)O1)=C(\O)/C=C/C(/C)=C/C(C)C5OC4(C)OC(\C=C/C34CO3)C5C
  • InChI=1S/C32H44N2O9/c1-16(14-17(2)28-18(3)23-12-13-32(15-40-32)31(6,42-23)43-28)8-9-22(36)25-27(37)26(19(4)29(38)33-7)34(30(25)39)24-11-10-21(35)20(5)41-24/h8-9,12-14,17-21,23-24,26,28,35-36H,10-11,15H2,1-7H3,(H,33,38)/b9-8+,16-14+,25-22+ checkY
  • Key:KVTPRMVXYZKLIG-NCFIBNQNSA-N checkY
 ☒NcheckY (what is this?)  (verify)

Streptolydigin (Stl) is an antibiotic that works by inhibiting nucleic acid chain elongation by binding to RNA polymerase, thus inhibiting RNA synthesis inside a cell.[1][2][3] Streptolydigin inhibits bacterial RNA polymerase, but not eukaryotic RNA polymerase.[4] It has antibacterial activity against a number of Gram positive bacteria.

References

  1. ^ Tuske S, Sarafianos SG, Wang X, Hudson B, Sineva E, Mukhopadhyay J, et al. (August 2005). "Inhibition of bacterial RNA polymerase by streptolydigin: stabilization of a straight-bridge-helix active-center conformation". Cell. 122 (4): 541–52. doi:10.1016/j.cell.2005.07.017. PMC 2754413. PMID 16122422.
  2. ^ Temiakov D, Zenkin N, Vassylyeva MN, Perederina A, Tahirov TH, Kashkina E, et al. (September 2005). "Structural basis of transcription inhibition by antibiotic streptolydigin". Molecular Cell. 19 (5): 655–66. doi:10.1016/j.molcel.2005.07.020. PMID 16167380.
  3. ^ Vassylyev DG, Vassylyeva MN, Zhang J, Palangat M, Artsimovitch I, Landick R (July 2007). "Structural basis for substrate loading in bacterial RNA polymerase". Nature. 448 (7150): 163–8. arXiv:0707.3064. Bibcode:2007Natur.448..163V. doi:10.1038/nature05931. PMID 17581591. S2CID 4320480.
  4. ^ Tuske S, Sarafianos SG, Wang X, Hudson B, Sineva E, Mukhopadhyay J, et al. (August 2005). "Inhibition of bacterial RNA polymerase by streptolydigin: stabilization of a straight-bridge-helix active-center conformation". Cell. 122 (4): 541–52. doi:10.1016/j.cell.2005.07.017. PMC 2754413. PMID 16122422.