Eprosartan: Difference between revisions
Updating {{drugbox}} (no changed fields - added verified revid - updated 'DrugBank_Ref', 'ChEBI_Ref', 'KEGG_Ref') per Chem/Drugbox validation (report [[Wikipedia talk:WikiProject_Pharmacology|err |
populated new fields in {{drugbox}} and reordered per bot approval. Report errors and suggestions to User_talk:BogBot |
||
Line 1: | Line 1: | ||
{{Drugbox| verifiedrevid = 443731045 |
{{Drugbox |
||
| verifiedrevid = 443731045 |
|||
⚫ | |||
| |
|||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Clinical data--> |
|||
| tradename = Teveten |
|||
| Drugs.com = {{drugs.com|monograph|teveten}} |
|||
| MedlinePlus = a601237 |
|||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Pharmacokinetic data--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Identifiers--> |
|||
| CASNo_Ref = {{cascite|correct|CAS}} |
| CASNo_Ref = {{cascite|correct|CAS}} |
||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 4444504 |
| ChemSpiderID = 4444504 |
||
⚫ | |||
⚫ | |||
| UNII_Ref = {{fdacite|correct|FDA}} |
| UNII_Ref = {{fdacite|correct|FDA}} |
||
| UNII = 2KH13Z0S0Y |
| UNII = 2KH13Z0S0Y |
||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Chemical data--> |
|||
⚫ | |||
⚫ | |||
| smiles = O=C(O)\C(=C\c1cnc(n1Cc2ccc(C(=O)O)cc2)CCCC)Cc3sccc3 |
| smiles = O=C(O)\C(=C\c1cnc(n1Cc2ccc(C(=O)O)cc2)CCCC)Cc3sccc3 |
||
⚫ | |||
| InChIKey = OROAFUQRIXKEMV-LDADJPATBR |
| InChIKey = OROAFUQRIXKEMV-LDADJPATBR |
||
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChI_Ref = {{stdinchicite|correct|chemspider}} |
||
Line 17: | Line 47: | ||
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} |
||
| StdInChIKey = OROAFUQRIXKEMV-LDADJPATSA-N |
| StdInChIKey = OROAFUQRIXKEMV-LDADJPATSA-N |
||
⚫ | |||
⚫ | |||
⚫ | |||
| ATC_supplemental= |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
}} |
}} |
||
Revision as of 09:48, 28 August 2011
Clinical data | |
---|---|
Trade names | Teveten |
AHFS/Drugs.com | Monograph |
MedlinePlus | a601237 |
Pregnancy category |
|
Routes of administration | Oral |
ATC code | |
Legal status | |
Legal status |
|
Pharmacokinetic data | |
Bioavailability | 15% (Eprosartan mesylate) |
Metabolism | not metabolized |
Elimination half-life | 5 to 9 hours |
Excretion | Renal 10%, biliary 90% |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
ChEBI | |
ChEMBL | |
CompTox Dashboard (EPA) | |
Chemical and physical data | |
Formula | C23H24N2O4S |
Molar mass | Eprosartan mesylate: 520.625 g/mol g·mol−1 |
3D model (JSmol) | |
| |
| |
(verify) |
Eprosartan is an angiotensin II receptor antagonist used for the treatment of high blood pressure. It is marketed as Teveten by Abbott Laboratories in the United States.It is marketed as Eprozar by INTAS Pharmaceuticals in the INDIA and by Solvay Pharmaceuticals elsewhere. It is sometimes paired with hydrochlorothiazide, marketed in the US as Teveten HCT and elsewhere as Teveten Plus.
The drug acts on the renin-angiotensin system in two ways to decrease total peripheral resistance. First, it blocks the binding of angiotensin II to AT1 receptors in vascular smooth muscle, causing vascular dilatation. Second, it inhibits sympathetic norepinephrine production, further reducing blood pressure.
As with other angiotensin II receptor antagonists, eprosartan is generally better tolerated than enalapril (an ACE inhibitor), especially among the elderly.[1]
See also
Angiotensin Receptor Blockers: Drug discovery and development
External links
References
- ^ Ruilope L, Jäger B, Prichard B (2001). "Eprosartan versus enalapril in elderly patients with hypertension: a double-blind, randomized trial". Blood Press. 10 (4): 223–9. doi:10.1080/08037050152669747. PMID 11800061.
{{cite journal}}
: CS1 maint: multiple names: authors list (link)