Eprosartan: Difference between revisions
Activating IUPHAR link. Report errors and suggestions to User_talk:BogBot |
m Infobox drug: rm/replace deprecated params. Fix unk parameters (rm some Chembox-params) (via AWB script) |
||
Line 4: | Line 4: | ||
| IUPAC_name = 4-({2-Butyl-5-[2-carboxy-2-(thiophen-2-ylmethyl)eth-1-en-1-yl]-1''H''-imidazol-1-yl}methyl)benzoic acid |
| IUPAC_name = 4-({2-Butyl-5-[2-carboxy-2-(thiophen-2-ylmethyl)eth-1-en-1-yl]-1''H''-imidazol-1-yl}methyl)benzoic acid |
||
| image = Eprosartan.svg |
| image = Eprosartan.svg |
||
<!--Clinical data--> |
<!--Clinical data--> |
||
| tradename = Teveten |
| tradename = Teveten |
||
Line 12: | Line 11: | ||
| legal_status = |
| legal_status = |
||
| routes_of_administration = Oral |
| routes_of_administration = Oral |
||
<!--Pharmacokinetic data--> |
<!--Pharmacokinetic data--> |
||
| bioavailability = 15% (Eprosartan mesylate) |
| bioavailability = 15% (Eprosartan mesylate) |
||
Line 18: | Line 16: | ||
| elimination_half-life = 5 to 9 hours |
| elimination_half-life = 5 to 9 hours |
||
| excretion = [[Renal]] 10%, [[biliary]] 90% |
| excretion = [[Renal]] 10%, [[biliary]] 90% |
||
<!--Identifiers--> |
<!--Identifiers--> |
||
| IUPHAR_ligand = 588 |
| IUPHAR_ligand = 588 |
||
| CASNo_Ref = {{cascite|correct|CAS}} |
|||
| CAS_number_Ref = {{cascite|correct|??}} |
| CAS_number_Ref = {{cascite|correct|??}} |
||
| CAS_number = 133040-01-4 |
| CAS_number = 133040-01-4 |
||
Line 28: | Line 24: | ||
| PubChem = 5281037 |
| PubChem = 5281037 |
||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
||
| DrugBank = DB00876 |
|||
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} |
||
| ChemSpiderID = 4444504 |
| ChemSpiderID = 4444504 |
||
Line 39: | Line 35: | ||
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
| ChEMBL_Ref = {{ebicite|correct|EBI}} |
||
| ChEMBL = 813 |
| ChEMBL = 813 |
||
<!--Chemical data--> |
<!--Chemical data--> |
||
| C=23 | H=24 | N=2 | O=4 | S=1 |
| C=23 | H=24 | N=2 | O=4 | S=1 |
||
| molecular_weight = Eprosartan mesylate: 520.625 g/mol |
| molecular_weight = Eprosartan mesylate: 520.625 g/mol |
||
| smiles = O=C(O)\C(=C\c1cnc(n1Cc2ccc(C(=O)O)cc2)CCCC)Cc3sccc3 |
| smiles = O=C(O)\C(=C\c1cnc(n1Cc2ccc(C(=O)O)cc2)CCCC)Cc3sccc3 |
Revision as of 09:57, 28 June 2015
Clinical data | |
---|---|
Trade names | Teveten |
AHFS/Drugs.com | Monograph |
MedlinePlus | a601237 |
Routes of administration | Oral |
ATC code | |
Pharmacokinetic data | |
Bioavailability | 15% (Eprosartan mesylate) |
Metabolism | not metabolized |
Elimination half-life | 5 to 9 hours |
Excretion | Renal 10%, biliary 90% |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
IUPHAR/BPS | |
DrugBank | |
ChemSpider | |
UNII | |
KEGG | |
ChEBI | |
ChEMBL | |
CompTox Dashboard (EPA) | |
Chemical and physical data | |
Formula | C23H24N2O4S |
Molar mass | Eprosartan mesylate: 520.625 g/mol g·mol−1 |
3D model (JSmol) | |
| |
| |
(verify) |
Eprosartan is an angiotensin II receptor antagonist used for the treatment of high blood pressure. It is marketed in the United States as Teveten by Abbvie, the spin-off of the pharmaceutical discovery division of Abbott Laboratories; it is marketed as Eprozar by INTAS Pharmaceuticals in India, and by Abbott Laboratories elsewhere. The compound came into the Abbott Laboratories cardiovascular pipeline with its acquisition of Kos Pharmaceuticals in 2006, which had licensed it, along with "a range of hypertensive treatments", from the Biovail Corporation.[1]
Eprosartan is sometimes paired with hydrochlorothiazide, whereupon it is marketed in the US as Teveten HCT and elsewhere as Teveten Plus.
The drug acts on the renin-angiotensin system to decrease total peripheral resistance in two ways. First, it blocks the binding of angiotensin II to AT1 receptors in vascular smooth muscle, causing vascular dilatation. Second, it inhibits sympathetic norepinephrine production, further reducing blood pressure.
As with other angiotensin II receptor antagonists, eprosartan is generally better tolerated than enalapril (an ACE inhibitor), especially among the elderly.[2]
See also
References
- ^ Anon., 2006, Abbott Laboratories: Kos Pharmaceuticals a wise buy, Datamonitor ResearchStore (online), November 8, 2006, see [1], accessed 29 January 2015.
- ^ Ruilope L, Jäger B, Prichard B (2001). "Eprosartan versus enalapril in elderly patients with hypertension: a double-blind, randomized trial". Blood Press. 10 (4): 223–9. doi:10.1080/08037050152669747. PMID 11800061.
{{cite journal}}
: CS1 maint: multiple names: authors list (link)