Tafluprost
{{Drugbox | IUPAC_name = Isopropyl (5Z)-7-{(1R,2R,3R,5S)-2-[(1E)-3,3-difluoro-4-phenoxybut-1-en-1-yl]-3,5-dihydroxycyclopentyl}hept-5-enoate | image = Tafluprost_structure.svg
| tradename = Saflutan, Taflotan, Tapros, Zioptan | Drugs.com = Multum Consumer Information | pregnancy_AU = | pregnancy_US = C | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = Rx-only | legal_status = | routes_of_administration = Topical (eye drops)
| bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
| CAS_number = 209860-87-7
| ATC_prefix = S01
| ATC_suffix = EE05
| ATC_supplemental =
| PubChem = 6433101
| ChEBI_Ref = 
| ChEBI = 66899
| DrugBank =
| ChEMBL = 1963683
| ChemSpiderID = 8044182
| UNII_Ref =
| UNII = 1O6WQ6T7G3
| KEGG = D06274
| chemical_formula = | C=25 | H=34 | F=2 | O=5 | molecular_weight = 452.531266 g/mol | smiles = CC(C)OC(=O)CCC\C=C/CC(C(O)CC1O)C1\C=C\C(F)(F)COc2ccccc2 | StdInChI = 1S/C25H34F2O5/c1-18(2)32-24(30)13-9-4-3-8-12-20-21(23(29)16-22(20)28)14-15-25(26,27)17-31-19-10-6-5-7-11-19/h3,5-8,10-11,14-15,18,20-23,28-29H,4,9,12-13,16-17H2,1-2H3/b8-3-,15-14+/t20-,21-,22+,23-/m1/s1 }}
Tafluprost (trade names Taflotan by Santen Pharmaceutical and Zioptan by Merck in the US) is a prostaglandin analogue used topically (as eye drops) to control the progression of glaucoma and in the management of ocular hypertension. It reduces intraocular pressure by increasing the outflow of aqueous fluid from the eyes.[1][2]
References
- ^ Multum Consumer Information on tafluprost ophthalmic.
- ^ Haberfeld, H, ed. (2015). Austria-Codex (in German). Vienna: Österreichischer Apothekerverlag.
 | This pharmacology-related article is a stub. You can help Wikipedia by expanding it. |