Lonazolac: Difference between revisions
Content deleted Content added
m Stub sorting and placement of stub template(s) |
Entranced98 (talk | contribs) Importing Wikidata short description: "Chemical compound" |
||
(18 intermediate revisions by 13 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{Drugbox |
{{Drugbox |
||
| Verifiedfields = changed |
|||
⚫ | |||
| Watchedfields = changed |
|||
⚫ | |||
| verifiedrevid = 447986412 |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Clinical data--> |
|||
⚫ | |||
| tradename = |
|||
⚫ | |||
⚫ | |||
| molecular_weight = 312.75032 g/mol |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| metabolism = |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| |
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> |
||
| legal_status = |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Pharmacokinetic data--> |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| |
| metabolism = |
||
⚫ | |||
⚫ | |||
⚫ | |||
<!--Identifiers--> |
|||
| CAS_number_Ref = {{cascite|correct|CAS}} |
|||
⚫ | |||
⚫ | |||
⚫ | |||
⚫ | |||
| DrugBank_Ref = {{drugbankcite|correct|drugbank}} |
|||
⚫ | |||
| UNII_Ref = {{fdacite|correct|FDA}} |
|||
| UNII = 13097143QI |
|||
| KEGG_Ref = {{keggcite|correct|kegg}} |
|||
| KEGG = D07265 |
|||
| ChEBI_Ref = {{ebicite|changed|EBI}} |
|||
| ChEBI = 76164 |
|||
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |
|||
| ChemSpiderID = 61957 |
|||
<!--Chemical data--> |
|||
⚫ | |||
| smiles = c1ccc(cc1)n2cc(c(n2)c3ccc(cc3)Cl)CC(=O)O |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChI = 1S/C17H13ClN2O2/c18-14-8-6-12(7-9-14)17-13(10-16(21)22)11-20(19-17)15-4-2-1-3-5-15/h1-9,11H,10H2,(H,21,22) |
|||
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |
|||
| StdInChIKey = XVUQHFRQHBLHQD-UHFFFAOYSA-N |
|||
}} |
}} |
||
'''Lonazolac''' is a [[ |
'''Lonazolac''' is a [[nonsteroidal anti-inflammatory drug]] (NSAID). |
||
==References== |
|||
{{Reflist|2}} |
|||
{{Anti-inflammatory and antirheumatic products}} |
{{Anti-inflammatory and antirheumatic products}} |
||
{{Prostanoidergics}} |
|||
{{NSAIDs}} |
|||
[[Category:Pyrazoles]] |
[[Category:Pyrazoles]] |
||
[[Category: |
[[Category:Nonsteroidal anti-inflammatory drugs]] |
||
[[Category: |
[[Category:Chloroarenes]] |
||
Latest revision as of 23:15, 29 January 2023
Clinical data | |
---|---|
ATC code | |
Identifiers | |
| |
CAS Number | |
PubChem CID | |
ChemSpider | |
UNII | |
KEGG | |
ChEBI | |
CompTox Dashboard (EPA) | |
ECHA InfoCard | 100.053.428 |
Chemical and physical data | |
Formula | C17H13ClN2O2 |
Molar mass | 312.75 g·mol−1 |
3D model (JSmol) | |
| |
| |
(what is this?) (verify) |
Lonazolac is a nonsteroidal anti-inflammatory drug (NSAID).
References[edit]