Lonazolac: Difference between revisions

From Wikipedia, the free encyclopedia
Content deleted Content added
No edit summary
Importing Wikidata short description: "Chemical compound"
 
(17 intermediate revisions by 12 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| IUPAC_name = [3-(4-chlorophenyl)-1-phenyl-1''H''-pyrazol-4-yl]acetic acid
| Watchedfields = changed
| image = lonazolac.png
| verifiedrevid = 447986412
| CAS_number =
| IUPAC_name = [3-(4-chlorophenyl)-1-phenyl-1''H''-pyrazol-4-yl]acetic acid
| ATC_prefix = M01
| image = lonazolac.png
| ATC_suffix = AB09

| PubChem = 68706
<!--Clinical data-->
| DrugBank =
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =

<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 53808-88-1
| ATC_prefix = M01
| ATC_suffix = AB09
| PubChem = 68706
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 13097143QI
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07265
| KEGG = D07265
| ChEBI_Ref = {{ebicite|changed|EBI}}
| C=17|H=13|Cl=1|N=2|O=2
| ChEBI = 76164
| molecular_weight = 312.75032 g/mol
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| bioavailability =
| protein_bound =
| ChemSpiderID = 61957

| metabolism =
<!--Chemical data-->
| elimination_half-life =
| excretion =
| C=17 | H=13 | Cl=1 | N=2 | O=2
| smiles = c1ccc(cc1)n2cc(c(n2)c3ccc(cc3)Cl)CC(=O)O
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| pregnancy_US = <!-- A / B / C / D / X -->
| StdInChI = 1S/C17H13ClN2O2/c18-14-8-6-12(7-9-14)17-13(10-16(21)22)11-20(19-17)15-4-2-1-3-5-15/h1-9,11H,10H2,(H,21,22)
| pregnancy_category=
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| StdInChIKey = XVUQHFRQHBLHQD-UHFFFAOYSA-N
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| routes_of_administration =
}}
}}


'''Lonazolac''' is a [[non-steroidal anti-inflammatory drug]].
'''Lonazolac''' is a [[nonsteroidal anti-inflammatory drug]] (NSAID).


==References==
{{Reflist|2}}




{{Anti-inflammatory and antirheumatic products}}
{{Anti-inflammatory and antirheumatic products}}
{{Prostanoidergics}}
{{NSAIDs}}


[[Category:Pyrazoles]]
[[Category:Pyrazoles]]
[[Category:Non-steroidal anti-inflammatory drugs]]
[[Category:Nonsteroidal anti-inflammatory drugs]]
[[Category:Organochlorides]]
[[Category:Chloroarenes]]





Latest revision as of 23:15, 29 January 2023

Lonazolac
Clinical data
ATC code
Identifiers
  • [3-(4-chlorophenyl)-1-phenyl-1H-pyrazol-4-yl]acetic acid
CAS Number
PubChem CID
ChemSpider
UNII
KEGG
ChEBI
CompTox Dashboard (EPA)
ECHA InfoCard100.053.428 Edit this at Wikidata
Chemical and physical data
FormulaC17H13ClN2O2
Molar mass312.75 g·mol−1
3D model (JSmol)
  • c1ccc(cc1)n2cc(c(n2)c3ccc(cc3)Cl)CC(=O)O
  • InChI=1S/C17H13ClN2O2/c18-14-8-6-12(7-9-14)17-13(10-16(21)22)11-20(19-17)15-4-2-1-3-5-15/h1-9,11H,10H2,(H,21,22) ☒N
  • Key:XVUQHFRQHBLHQD-UHFFFAOYSA-N ☒N
 ☒NcheckY (what is this?)  (verify)

Lonazolac is a nonsteroidal anti-inflammatory drug (NSAID).

References[edit]