Lonazolac: Difference between revisions
Content deleted Content added
removed Category:Organochlorides; added Category:Chloroarenes using HotCat |
m Remove redundant parameters InChI, InChIKey (StdInChI, StdInChIKey are used). See Talk (via AWB script) |
||
Line 45: | Line 45: | ||
| molecular_weight = 312.75032 g/mol |
| molecular_weight = 312.75032 g/mol |
||
| smiles = c1ccc(cc1)n2cc(c(n2)c3ccc(cc3)Cl)CC(=O)O |
| smiles = c1ccc(cc1)n2cc(c(n2)c3ccc(cc3)Cl)CC(=O)O |
||
| InChI = 1/C17H13ClN2O2/c18-14-8-6-12(7-9-14)17-13(10-16(21)22)11-20(19-17)15-4-2-1-3-5-15/h1-9,11H,10H2,(H,21,22) |
|||
| InChIKey = XVUQHFRQHBLHQD-UHFFFAOYAF |
|||
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
| StdInChI_Ref = {{stdinchicite|changed|chemspider}} |
||
| StdInChI = 1S/C17H13ClN2O2/c18-14-8-6-12(7-9-14)17-13(10-16(21)22)11-20(19-17)15-4-2-1-3-5-15/h1-9,11H,10H2,(H,21,22) |
| StdInChI = 1S/C17H13ClN2O2/c18-14-8-6-12(7-9-14)17-13(10-16(21)22)11-20(19-17)15-4-2-1-3-5-15/h1-9,11H,10H2,(H,21,22) |
Revision as of 17:47, 2 April 2016
Clinical data | |
---|---|
ATC code | |
Identifiers | |
| |
PubChem CID | |
ChemSpider | |
UNII | |
KEGG | |
ChEBI | |
CompTox Dashboard (EPA) | |
ECHA InfoCard | 100.053.428 |
Chemical and physical data | |
Formula | C17H13ClN2O2 |
Molar mass | 312.75032 g/mol g·mol−1 |
3D model (JSmol) | |
| |
| |
(what is this?) (verify) |
Lonazolac is a non-steroidal anti-inflammatory drug.
References